C23H24IN3O5 — CID 3313873
N-(4-ethoxyphenyl)-N'-[(3-iodo-5-methoxy-4-prop-2-ynoxyphenyl)methylideneamino]butanediamide (PubChem CID 3313873) has the molecular formula C23H24IN3O5 and a molecular weight of 549.37 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-N'-[(3-iodo-5-methoxy-4-prop-2-ynoxyphenyl)methylideneamino]butanediamide.
| Compound Name | N-(4-ethoxyphenyl)-N'-[(3-iodo-5-methoxy-4-prop-2-ynoxyphenyl)methylideneamino]butanediamide |
|---|---|
| PubChem CID | 3313873 |
| Molecular Formula | C23H24IN3O5 |
| Molecular Weight | 549.37 g/mol |
| Exact Mass | 549.08 |
| IUPAC Name | N-(4-ethoxyphenyl)-N'-[(3-iodo-5-methoxy-4-prop-2-ynoxyphenyl)methylideneamino]butanediamide |
| SMILES | C#CCOc1c(I)cc(C=NNC(=O)CCC(=O)Nc2ccc(OCC)cc2)cc1OC |
| InChI | InChI=1S/C23H24IN3O5/c1-4-12-32-23-19(24)13-16(14-20(23)30-3)15-25-27-22(29)11-10-21(28)26-17-6-8-18(9-7-17)31-5-2/h1,6-9,13-15H,5,10-12H2,2-3H3,(H,26,28)(H,27,29) |
| InChIKey | VFGMOUSSHZNLPQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.37 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|