C22H26IN3O5 — CID 3264941
N'-[(3-iodo-5-methoxy-4-propoxyphenyl)methylideneamino]-N-(4-methoxyphenyl)butanediamide (PubChem CID 3264941) has the molecular formula C22H26IN3O5 and a molecular weight of 539.37 g/mol. Its IUPAC name is N'-[(3-iodo-5-methoxy-4-propoxyphenyl)methylideneamino]-N-(4-methoxyphenyl)butanediamide.
| Compound Name | N'-[(3-iodo-5-methoxy-4-propoxyphenyl)methylideneamino]-N-(4-methoxyphenyl)butanediamide |
|---|---|
| PubChem CID | 3264941 |
| Molecular Formula | C22H26IN3O5 |
| Molecular Weight | 539.37 g/mol |
| Exact Mass | 539.09 |
| IUPAC Name | N'-[(3-iodo-5-methoxy-4-propoxyphenyl)methylideneamino]-N-(4-methoxyphenyl)butanediamide |
| SMILES | CCCOc1c(I)cc(C=NNC(=O)CCC(=O)Nc2ccc(OC)cc2)cc1OC |
| InChI | InChI=1S/C22H26IN3O5/c1-4-11-31-22-18(23)12-15(13-19(22)30-3)14-24-26-21(28)10-9-20(27)25-16-5-7-17(29-2)8-6-16/h5-8,12-14H,4,9-11H2,1-3H3,(H,25,27)(H,26,28) |
| InChIKey | VHXPMCKWOPOWQM-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.37 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|