C19H22BrNO3 — CID 50884560
1-(3-bromo-4,5-diethoxyphenyl)-N-(4-ethoxyphenyl)methanimine (PubChem CID 50884560) has the molecular formula C19H22BrNO3 and a molecular weight of 392.29 g/mol. Its IUPAC name is 1-(3-bromo-4,5-diethoxyphenyl)-N-(4-ethoxyphenyl)methanimine.
| Compound Name | 1-(3-bromo-4,5-diethoxyphenyl)-N-(4-ethoxyphenyl)methanimine |
|---|---|
| PubChem CID | 50884560 |
| Molecular Formula | C19H22BrNO3 |
| Molecular Weight | 392.29 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | 1-(3-bromo-4,5-diethoxyphenyl)-N-(4-ethoxyphenyl)methanimine |
| SMILES | CCOc1ccc(/N=C/c2cc(Br)c(OCC)c(OCC)c2)cc1 |
| InChI | InChI=1S/C19H22BrNO3/c1-4-22-16-9-7-15(8-10-16)21-13-14-11-17(20)19(24-6-3)18(12-14)23-5-2/h7-13H,4-6H2,1-3H3/b21-13+ |
| InChIKey | CHXITVBXIQXMIT-FYJGNVAPSA-N |
| XLogP | 5.40 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.29 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|