C18H17Br2NO2 — CID 126205744
1-(3,5-dibromo-4-prop-2-enoxyphenyl)-N-(4-ethoxyphenyl)methanimine (PubChem CID 126205744) has the molecular formula C18H17Br2NO2 and a molecular weight of 439.15 g/mol. Its IUPAC name is 1-(3,5-dibromo-4-prop-2-enoxyphenyl)-N-(4-ethoxyphenyl)methanimine.
| Compound Name | 1-(3,5-dibromo-4-prop-2-enoxyphenyl)-N-(4-ethoxyphenyl)methanimine |
|---|---|
| PubChem CID | 126205744 |
| Molecular Formula | C18H17Br2NO2 |
| Molecular Weight | 439.15 g/mol |
| Exact Mass | 436.96 |
| IUPAC Name | 1-(3,5-dibromo-4-prop-2-enoxyphenyl)-N-(4-ethoxyphenyl)methanimine |
| SMILES | C=CCOc1c(Br)cc(/C=N/c2ccc(OCC)cc2)cc1Br |
| InChI | InChI=1S/C18H17Br2NO2/c1-3-9-23-18-16(19)10-13(11-17(18)20)12-21-14-5-7-15(8-6-14)22-4-2/h3,5-8,10-12H,1,4,9H2,2H3/b21-12+ |
| InChIKey | DINHJXNQNSQTSO-CIAFOILYSA-N |
| XLogP | 5.93 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.15 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|