C17H15Br2NO — CID 126207235
1-(3,5-dibromo-4-prop-2-enoxyphenyl)-N-(2-methylphenyl)methanimine (PubChem CID 126207235) has the molecular formula C17H15Br2NO and a molecular weight of 409.12 g/mol. Its IUPAC name is 1-(3,5-dibromo-4-prop-2-enoxyphenyl)-N-(2-methylphenyl)methanimine.
| Compound Name | 1-(3,5-dibromo-4-prop-2-enoxyphenyl)-N-(2-methylphenyl)methanimine |
|---|---|
| PubChem CID | 126207235 |
| Molecular Formula | C17H15Br2NO |
| Molecular Weight | 409.12 g/mol |
| Exact Mass | 406.95 |
| IUPAC Name | 1-(3,5-dibromo-4-prop-2-enoxyphenyl)-N-(2-methylphenyl)methanimine |
| SMILES | C=CCOc1c(Br)cc(/C=N/c2ccccc2C)cc1Br |
| InChI | InChI=1S/C17H15Br2NO/c1-3-8-21-17-14(18)9-13(10-15(17)19)11-20-16-7-5-4-6-12(16)2/h3-7,9-11H,1,8H2,2H3/b20-11+ |
| InChIKey | LGEKXHSZTSPATO-RGVLZGJSSA-N |
| XLogP | 5.84 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.12 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|