C12H10Br2N4O — CID 6080827
(Z)-1-(3,5-dibromo-4-prop-2-enoxyphenyl)-N-(1,2,4-triazol-4-yl)methanimine (PubChem CID 6080827) has the molecular formula C12H10Br2N4O and a molecular weight of 386.05 g/mol. Its IUPAC name is (Z)-1-(3,5-dibromo-4-prop-2-enoxyphenyl)-N-(1,2,4-triazol-4-yl)methanimine.
| Compound Name | (Z)-1-(3,5-dibromo-4-prop-2-enoxyphenyl)-N-(1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 6080827 |
| Molecular Formula | C12H10Br2N4O |
| Molecular Weight | 386.05 g/mol |
| Exact Mass | 383.92 |
| IUPAC Name | (Z)-1-(3,5-dibromo-4-prop-2-enoxyphenyl)-N-(1,2,4-triazol-4-yl)methanimine |
| SMILES | C=CCOc1c(Br)cc(/C=N\n2cnnc2)cc1Br |
| InChI | InChI=1S/C12H10Br2N4O/c1-2-3-19-12-10(13)4-9(5-11(12)14)6-17-18-7-15-16-8-18/h2,4-8H,1,3H2/b17-6- |
| InChIKey | BJBCYVJGJPJCSM-FMQZQXMHSA-N |
| XLogP | 3.25 |
| TPSA | 52.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.05 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|