C13H15BrN4O2 — CID 727347
1-(3-bromo-4,5-diethoxyphenyl)-N-(1,2,4-triazol-4-yl)methanimine (PubChem CID 727347) has the molecular formula C13H15BrN4O2 and a molecular weight of 339.19 g/mol. Its IUPAC name is 1-(3-bromo-4,5-diethoxyphenyl)-N-(1,2,4-triazol-4-yl)methanimine.
| Compound Name | 1-(3-bromo-4,5-diethoxyphenyl)-N-(1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 727347 |
| Molecular Formula | C13H15BrN4O2 |
| Molecular Weight | 339.19 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | 1-(3-bromo-4,5-diethoxyphenyl)-N-(1,2,4-triazol-4-yl)methanimine |
| SMILES | CCOc1cc(C=Nn2cnnc2)cc(Br)c1OCC |
| InChI | InChI=1S/C13H15BrN4O2/c1-3-19-12-6-10(5-11(14)13(12)20-4-2)7-17-18-8-15-16-9-18/h5-9H,3-4H2,1-2H3 |
| InChIKey | YQOKNYSIZFWBDH-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 61.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.19 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|