C19H19ClN4O3 — CID 3914435
1-[3-chloro-5-ethoxy-4-(2-phenoxyethoxy)phenyl]-N-(1,2,4-triazol-4-yl)methanimine (PubChem CID 3914435) has the molecular formula C19H19ClN4O3 and a molecular weight of 386.84 g/mol. Its IUPAC name is 1-[3-chloro-5-ethoxy-4-(2-phenoxyethoxy)phenyl]-N-(1,2,4-triazol-4-yl)methanimine.
| Compound Name | 1-[3-chloro-5-ethoxy-4-(2-phenoxyethoxy)phenyl]-N-(1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 3914435 |
| Molecular Formula | C19H19ClN4O3 |
| Molecular Weight | 386.84 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 1-[3-chloro-5-ethoxy-4-(2-phenoxyethoxy)phenyl]-N-(1,2,4-triazol-4-yl)methanimine |
| SMILES | CCOc1cc(C=Nn2cnnc2)cc(Cl)c1OCCOc1ccccc1 |
| InChI | InChI=1S/C19H19ClN4O3/c1-2-25-18-11-15(12-23-24-13-21-22-14-24)10-17(20)19(18)27-9-8-26-16-6-4-3-5-7-16/h3-7,10-14H,2,8-9H2,1H3 |
| InChIKey | FYQXFISSEGHYJI-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 70.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.84 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|