C18H20ClNO3 — CID 42206329
(NE)-N-[[3-chloro-5-ethoxy-4-(3-phenylpropoxy)phenyl]methylidene]hydroxylamine (PubChem CID 42206329) has the molecular formula C18H20ClNO3 and a molecular weight of 333.82 g/mol. Its IUPAC name is (NE)-N-[[3-chloro-5-ethoxy-4-(3-phenylpropoxy)phenyl]methylidene]hydroxylamine.
| Compound Name | (NE)-N-[[3-chloro-5-ethoxy-4-(3-phenylpropoxy)phenyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 42206329 |
| Molecular Formula | C18H20ClNO3 |
| Molecular Weight | 333.82 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | (NE)-N-[[3-chloro-5-ethoxy-4-(3-phenylpropoxy)phenyl]methylidene]hydroxylamine |
| SMILES | CCOc1cc(/C=N/O)cc(Cl)c1OCCCc1ccccc1 |
| InChI | InChI=1S/C18H20ClNO3/c1-2-22-17-12-15(13-20-21)11-16(19)18(17)23-10-6-9-14-7-4-3-5-8-14/h3-5,7-8,11-13,21H,2,6,9-10H2,1H3/b20-13+ |
| InChIKey | QYULQWZSAYGUEO-DEDYPNTBSA-N |
| XLogP | 4.56 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.82 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|