C16H15Cl2NO3 — CID 20985091
N-[[3-chloro-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]hydroxylamine (PubChem CID 20985091) has the molecular formula C16H15Cl2NO3 and a molecular weight of 340.21 g/mol. Its IUPAC name is N-[[3-chloro-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]hydroxylamine.
| Compound Name | N-[[3-chloro-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 20985091 |
| Molecular Formula | C16H15Cl2NO3 |
| Molecular Weight | 340.21 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | N-[[3-chloro-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]hydroxylamine |
| SMILES | CCOc1cc(C=NO)cc(Cl)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C16H15Cl2NO3/c1-2-21-15-8-11(9-19-20)7-14(18)16(15)22-10-12-5-3-4-6-13(12)17/h3-9,20H,2,10H2,1H3 |
| InChIKey | WTNQGRZQCWFAFQ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.21 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|