C12H13N5O4 — CID 5076741
1-(4-ethoxy-3-methoxy-5-nitrophenyl)-N-(1,2,4-triazol-4-yl)methanimine (PubChem CID 5076741) has the molecular formula C12H13N5O4 and a molecular weight of 291.27 g/mol. Its IUPAC name is 1-(4-ethoxy-3-methoxy-5-nitrophenyl)-N-(1,2,4-triazol-4-yl)methanimine.
| Compound Name | 1-(4-ethoxy-3-methoxy-5-nitrophenyl)-N-(1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 5076741 |
| Molecular Formula | C12H13N5O4 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 1-(4-ethoxy-3-methoxy-5-nitrophenyl)-N-(1,2,4-triazol-4-yl)methanimine |
| SMILES | CCOc1c(OC)cc(C=Nn2cnnc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H13N5O4/c1-3-21-12-10(17(18)19)4-9(5-11(12)20-2)6-15-16-7-13-14-8-16/h4-8H,3H2,1-2H3 |
| InChIKey | SQWKAZPTJQKIBN-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 104.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|