C15H17BrN4O3S — CID 110507730
4-[(Z)-(3-bromo-4,5-diethoxyphenyl)methylideneamino]-6-methyl-3-sulfanylidene-2H-1,2,4-triazin-5-one (PubChem CID 110507730) has the molecular formula C15H17BrN4O3S and a molecular weight of 413.30 g/mol. Its IUPAC name is 4-[(Z)-(3-bromo-4,5-diethoxyphenyl)methylideneamino]-6-methyl-3-sulfanylidene-2H-1,2,4-triazin-5-one.
| Compound Name | 4-[(Z)-(3-bromo-4,5-diethoxyphenyl)methylideneamino]-6-methyl-3-sulfanylidene-2H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 110507730 |
| Molecular Formula | C15H17BrN4O3S |
| Molecular Weight | 413.30 g/mol |
| Exact Mass | 412.02 |
| IUPAC Name | 4-[(Z)-(3-bromo-4,5-diethoxyphenyl)methylideneamino]-6-methyl-3-sulfanylidene-2H-1,2,4-triazin-5-one |
| SMILES | CCOc1cc(/C=N\n2c(=S)[nH]nc(C)c2=O)cc(Br)c1OCC |
| InChI | InChI=1S/C15H17BrN4O3S/c1-4-22-12-7-10(6-11(16)13(12)23-5-2)8-17-20-14(21)9(3)18-19-15(20)24/h6-8H,4-5H2,1-3H3,(H,19,24)/b17-8- |
| InChIKey | FQZHIKWNRSODLQ-IUXPMGMMSA-N |
| XLogP | 3.05 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|