C12H13BrN4O2S — CID 135617953
4-[(E)-(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-3-methyl-1H-1,2,4-triazole-5-thione (PubChem CID 135617953) has the molecular formula C12H13BrN4O2S and a molecular weight of 357.23 g/mol. Its IUPAC name is 4-[(E)-(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-3-methyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(E)-(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-3-methyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 135617953 |
| Molecular Formula | C12H13BrN4O2S |
| Molecular Weight | 357.23 g/mol |
| Exact Mass | 355.99 |
| IUPAC Name | 4-[(E)-(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-3-methyl-1H-1,2,4-triazole-5-thione |
| SMILES | CCOc1cc(/C=N/n2c(C)n[nH]c2=S)cc(Br)c1O |
| InChI | InChI=1S/C12H13BrN4O2S/c1-3-19-10-5-8(4-9(13)11(10)18)6-14-17-7(2)15-16-12(17)20/h4-6,18H,3H2,1-2H3,(H,16,20)/b14-6+ |
| InChIKey | WMZACRZRIXRGCC-MKMNVTDBSA-N |
| XLogP | 3.00 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.23 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|