C11H8BrF3N4O2S — CID 1308286
4-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-3-(trifluoromethyl)-1H-1,2,4-triazole-5-thione (PubChem CID 1308286) has the molecular formula C11H8BrF3N4O2S and a molecular weight of 397.18 g/mol. Its IUPAC name is 4-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-3-(trifluoromethyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-3-(trifluoromethyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 1308286 |
| Molecular Formula | C11H8BrF3N4O2S |
| Molecular Weight | 397.18 g/mol |
| Exact Mass | 395.95 |
| IUPAC Name | 4-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-3-(trifluoromethyl)-1H-1,2,4-triazole-5-thione |
| SMILES | COc1cc(C=Nn2c(C(F)(F)F)n[nH]c2=S)cc(Br)c1O |
| InChI | InChI=1S/C11H8BrF3N4O2S/c1-21-7-3-5(2-6(12)8(7)20)4-16-19-9(11(13,14)15)17-18-10(19)22/h2-4,20H,1H3,(H,18,22) |
| InChIKey | QGCJOGZZTICXPQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.18 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|