C11H8F3N5O4S — CID 135576037
4-[(Z)-(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-3-(trifluoromethyl)-1H-1,2,4-triazole-5-thione (PubChem CID 135576037) has the molecular formula C11H8F3N5O4S and a molecular weight of 363.28 g/mol. Its IUPAC name is 4-[(Z)-(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-3-(trifluoromethyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(Z)-(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-3-(trifluoromethyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 135576037 |
| Molecular Formula | C11H8F3N5O4S |
| Molecular Weight | 363.28 g/mol |
| Exact Mass | 363.02 |
| IUPAC Name | 4-[(Z)-(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-3-(trifluoromethyl)-1H-1,2,4-triazole-5-thione |
| SMILES | COc1cc(/C=N\n2c(C(F)(F)F)n[nH]c2=S)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C11H8F3N5O4S/c1-23-7-3-5(2-6(8(7)20)19(21)22)4-15-18-9(11(12,13)14)16-17-10(18)24/h2-4,20H,1H3,(H,17,24)/b15-4- |
| InChIKey | KLNUDQBUKXNOAU-TVPGTPATSA-N |
| XLogP | 2.46 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|