C18H23F3N4OS — CID 136874113
4-[(Z)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-3-(trifluoromethyl)-1H-1,2,4-triazole-5-thione (PubChem CID 136874113) has the molecular formula C18H23F3N4OS and a molecular weight of 400.47 g/mol. Its IUPAC name is 4-[(Z)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-3-(trifluoromethyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(Z)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-3-(trifluoromethyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 136874113 |
| Molecular Formula | C18H23F3N4OS |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 4-[(Z)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-3-(trifluoromethyl)-1H-1,2,4-triazole-5-thione |
| SMILES | CC(C)(C)c1cc(/C=N\n2c(C(F)(F)F)n[nH]c2=S)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C18H23F3N4OS/c1-16(2,3)11-7-10(8-12(13(11)26)17(4,5)6)9-22-25-14(18(19,20)21)23-24-15(25)27/h7-9,26H,1-6H3,(H,24,27)/b22-9- |
| InChIKey | SPWBFMULGJGXHJ-AFPJDJCSSA-N |
| XLogP | 5.14 |
| TPSA | 66.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|