C22H34N4OS — CID 136873847
4-[(Z)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-3-pentan-3-yl-1H-1,2,4-triazole-5-thione (PubChem CID 136873847) has the molecular formula C22H34N4OS and a molecular weight of 402.61 g/mol. Its IUPAC name is 4-[(Z)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-3-pentan-3-yl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(Z)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-3-pentan-3-yl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 136873847 |
| Molecular Formula | C22H34N4OS |
| Molecular Weight | 402.61 g/mol |
| Exact Mass | 402.25 |
| IUPAC Name | 4-[(Z)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-3-pentan-3-yl-1H-1,2,4-triazole-5-thione |
| SMILES | CCC(CC)c1n[nH]c(=S)n1/N=C\c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C22H34N4OS/c1-9-15(10-2)19-24-25-20(28)26(19)23-13-14-11-16(21(3,4)5)18(27)17(12-14)22(6,7)8/h11-13,15,27H,9-10H2,1-8H3,(H,25,28)/b23-13- |
| InChIKey | XKNLVRJZZVKPTG-QRVIBDJDSA-N |
| XLogP | 6.03 |
| TPSA | 66.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.61 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|