C20H28N4OS — CID 135575985
3-cyclopropyl-4-[(E)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione (PubChem CID 135575985) has the molecular formula C20H28N4OS and a molecular weight of 372.54 g/mol. Its IUPAC name is 3-cyclopropyl-4-[(E)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-cyclopropyl-4-[(E)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 135575985 |
| Molecular Formula | C20H28N4OS |
| Molecular Weight | 372.54 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 3-cyclopropyl-4-[(E)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione |
| SMILES | CC(C)(C)c1cc(/C=N/n2c(C3CC3)n[nH]c2=S)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C20H28N4OS/c1-19(2,3)14-9-12(10-15(16(14)25)20(4,5)6)11-21-24-17(13-7-8-13)22-23-18(24)26/h9-11,13,25H,7-8H2,1-6H3,(H,23,26)/b21-11+ |
| InChIKey | DUNPJRGZMNGOJV-SRZZPIQSSA-N |
| XLogP | 5.00 |
| TPSA | 66.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.54 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|