C12H11FN4S — CID 9358177
3-cyclopropyl-4-[(Z)-(3-fluorophenyl)methylideneamino]-1H-1,2,4-triazole-5-thione (PubChem CID 9358177) has the molecular formula C12H11FN4S and a molecular weight of 262.31 g/mol. Its IUPAC name is 3-cyclopropyl-4-[(Z)-(3-fluorophenyl)methylideneamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-cyclopropyl-4-[(Z)-(3-fluorophenyl)methylideneamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 9358177 |
| Molecular Formula | C12H11FN4S |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 3-cyclopropyl-4-[(Z)-(3-fluorophenyl)methylideneamino]-1H-1,2,4-triazole-5-thione |
| SMILES | Fc1cccc(/C=N\n2c(C3CC3)n[nH]c2=S)c1 |
| InChI | InChI=1S/C12H11FN4S/c13-10-3-1-2-8(6-10)7-14-17-11(9-4-5-9)15-16-12(17)18/h1-3,6-7,9H,4-5H2,(H,16,18)/b14-7- |
| InChIKey | IKXTXEKMCFSJPY-AUWJEWJLSA-N |
| XLogP | 2.84 |
| TPSA | 45.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|