C12H10ClN5O2S — CID 9358202
4-[(Z)-(4-chloro-3-nitrophenyl)methylideneamino]-3-cyclopropyl-1H-1,2,4-triazole-5-thione (PubChem CID 9358202) has the molecular formula C12H10ClN5O2S and a molecular weight of 323.77 g/mol. Its IUPAC name is 4-[(Z)-(4-chloro-3-nitrophenyl)methylideneamino]-3-cyclopropyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(Z)-(4-chloro-3-nitrophenyl)methylideneamino]-3-cyclopropyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 9358202 |
| Molecular Formula | C12H10ClN5O2S |
| Molecular Weight | 323.77 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | 4-[(Z)-(4-chloro-3-nitrophenyl)methylideneamino]-3-cyclopropyl-1H-1,2,4-triazole-5-thione |
| SMILES | O=[N+]([O-])c1cc(/C=N\n2c(C3CC3)n[nH]c2=S)ccc1Cl |
| InChI | InChI=1S/C12H10ClN5O2S/c13-9-4-1-7(5-10(9)18(19)20)6-14-17-11(8-2-3-8)15-16-12(17)21/h1,4-6,8H,2-3H2,(H,16,21)/b14-6- |
| InChIKey | LIHXCZKCOQEQCB-NSIKDUERSA-N |
| XLogP | 3.26 |
| TPSA | 89.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.77 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|