C12H10ClN5O3S — CID 135575999
4-[(Z)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-3-cyclopropyl-1H-1,2,4-triazole-5-thione (PubChem CID 135575999) has the molecular formula C12H10ClN5O3S and a molecular weight of 339.76 g/mol. Its IUPAC name is 4-[(Z)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-3-cyclopropyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(Z)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-3-cyclopropyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 135575999 |
| Molecular Formula | C12H10ClN5O3S |
| Molecular Weight | 339.76 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | 4-[(Z)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-3-cyclopropyl-1H-1,2,4-triazole-5-thione |
| SMILES | O=[N+]([O-])c1cc(Cl)cc(/C=N\n2c(C3CC3)n[nH]c2=S)c1O |
| InChI | InChI=1S/C12H10ClN5O3S/c13-8-3-7(10(19)9(4-8)18(20)21)5-14-17-11(6-1-2-6)15-16-12(17)22/h3-6,19H,1-2H2,(H,16,22)/b14-5- |
| InChIKey | SJTJVHHSCBUBDG-RZNTYIFUSA-N |
| XLogP | 2.97 |
| TPSA | 109.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.76 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|