C15H9ClFN5O3S — CID 135557584
4-[(E)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-3-(3-fluorophenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 135557584) has the molecular formula C15H9ClFN5O3S and a molecular weight of 393.79 g/mol. Its IUPAC name is 4-[(E)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-3-(3-fluorophenyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(E)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-3-(3-fluorophenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 135557584 |
| Molecular Formula | C15H9ClFN5O3S |
| Molecular Weight | 393.79 g/mol |
| Exact Mass | 393.01 |
| IUPAC Name | 4-[(E)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-3-(3-fluorophenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | O=[N+]([O-])c1cc(Cl)cc(/C=N/n2c(-c3cccc(F)c3)n[nH]c2=S)c1O |
| InChI | InChI=1S/C15H9ClFN5O3S/c16-10-4-9(13(23)12(6-10)22(24)25)7-18-21-14(19-20-15(21)26)8-2-1-3-11(17)5-8/h1-7,23H,(H,20,26)/b18-7+ |
| InChIKey | OAGPMGWJOJPISS-CNHKJKLMSA-N |
| XLogP | 3.90 |
| TPSA | 109.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.79 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|