C15H10BrN5O3S — CID 135470794
4-[(E)-(3-bromo-2-hydroxy-5-nitrophenyl)methylideneamino]-3-phenyl-1H-1,2,4-triazole-5-thione (PubChem CID 135470794) has the molecular formula C15H10BrN5O3S and a molecular weight of 420.25 g/mol. Its IUPAC name is 4-[(E)-(3-bromo-2-hydroxy-5-nitrophenyl)methylideneamino]-3-phenyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(E)-(3-bromo-2-hydroxy-5-nitrophenyl)methylideneamino]-3-phenyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 135470794 |
| Molecular Formula | C15H10BrN5O3S |
| Molecular Weight | 420.25 g/mol |
| Exact Mass | 418.97 |
| IUPAC Name | 4-[(E)-(3-bromo-2-hydroxy-5-nitrophenyl)methylideneamino]-3-phenyl-1H-1,2,4-triazole-5-thione |
| SMILES | O=[N+]([O-])c1cc(Br)c(O)c(/C=N/n2c(-c3ccccc3)n[nH]c2=S)c1 |
| InChI | InChI=1S/C15H10BrN5O3S/c16-12-7-11(21(23)24)6-10(13(12)22)8-17-20-14(18-19-15(20)25)9-4-2-1-3-5-9/h1-8,22H,(H,19,25)/b17-8+ |
| InChIKey | UVQZGPPDBVHAND-CAOOACKPSA-N |
| XLogP | 3.87 |
| TPSA | 109.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.25 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|