C21H15N5O4S2 — CID 42644454
3-[4-(benzenesulfonyl)phenyl]-4-[(E)-(3-nitrophenyl)methylideneamino]-1H-1,2,4-triazole-5-thione (PubChem CID 42644454) has the molecular formula C21H15N5O4S2 and a molecular weight of 465.52 g/mol. Its IUPAC name is 3-[4-(benzenesulfonyl)phenyl]-4-[(E)-(3-nitrophenyl)methylideneamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[4-(benzenesulfonyl)phenyl]-4-[(E)-(3-nitrophenyl)methylideneamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 42644454 |
| Molecular Formula | C21H15N5O4S2 |
| Molecular Weight | 465.52 g/mol |
| Exact Mass | 465.06 |
| IUPAC Name | 3-[4-(benzenesulfonyl)phenyl]-4-[(E)-(3-nitrophenyl)methylideneamino]-1H-1,2,4-triazole-5-thione |
| SMILES | O=[N+]([O-])c1cccc(/C=N/n2c(-c3ccc(S(=O)(=O)c4ccccc4)cc3)n[nH]c2=S)c1 |
| InChI | InChI=1S/C21H15N5O4S2/c27-26(28)17-6-4-5-15(13-17)14-22-25-20(23-24-21(25)31)16-9-11-19(12-10-16)32(29,30)18-7-2-1-3-8-18/h1-14H,(H,24,31)/b22-14+ |
| InChIKey | BETPNCRMLQLRFI-HYARGMPZSA-N |
| XLogP | 4.23 |
| TPSA | 123.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.52 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|