C22H16BrN5O3S — CID 126068667
4-[(Z)-[3-bromo-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-3-phenyl-1H-1,2,4-triazole-5-thione (PubChem CID 126068667) has the molecular formula C22H16BrN5O3S and a molecular weight of 510.37 g/mol. Its IUPAC name is 4-[(Z)-[3-bromo-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-3-phenyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(Z)-[3-bromo-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-3-phenyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 126068667 |
| Molecular Formula | C22H16BrN5O3S |
| Molecular Weight | 510.37 g/mol |
| Exact Mass | 509.02 |
| IUPAC Name | 4-[(Z)-[3-bromo-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-3-phenyl-1H-1,2,4-triazole-5-thione |
| SMILES | O=[N+]([O-])c1cccc(COc2ccc(/C=N\n3c(-c4ccccc4)n[nH]c3=S)cc2Br)c1 |
| InChI | InChI=1S/C22H16BrN5O3S/c23-19-12-15(9-10-20(19)31-14-16-5-4-8-18(11-16)28(29)30)13-24-27-21(25-26-22(27)32)17-6-2-1-3-7-17/h1-13H,14H2,(H,26,32)/b24-13- |
| InChIKey | RHIJVEKRKWLNPL-CFRMEGHHSA-N |
| XLogP | 5.74 |
| TPSA | 98.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.37 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|