C15H8ClN3O5 — CID 135757360
2-[(Z)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]isoindole-1,3-dione (PubChem CID 135757360) has the molecular formula C15H8ClN3O5 and a molecular weight of 345.70 g/mol. Its IUPAC name is 2-[(Z)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]isoindole-1,3-dione.
| Compound Name | 2-[(Z)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 135757360 |
| Molecular Formula | C15H8ClN3O5 |
| Molecular Weight | 345.70 g/mol |
| Exact Mass | 345.02 |
| IUPAC Name | 2-[(Z)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1/N=C\c1cc(Cl)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C15H8ClN3O5/c16-9-5-8(13(20)12(6-9)19(23)24)7-17-18-14(21)10-3-1-2-4-11(10)15(18)22/h1-7,20H/b17-7- |
| InChIKey | FSWWIDUTCIMLHG-IDUWFGFVSA-N |
| XLogP | 2.58 |
| TPSA | 113.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.70 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|