C16H9N3O6 — CID 759274
2-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]isoindole-1,3-dione (PubChem CID 759274) has the molecular formula C16H9N3O6 and a molecular weight of 339.26 g/mol. Its IUPAC name is 2-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]isoindole-1,3-dione.
| Compound Name | 2-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 759274 |
| Molecular Formula | C16H9N3O6 |
| Molecular Weight | 339.26 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | 2-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1N=Cc1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C16H9N3O6/c20-15-10-3-1-2-4-11(10)16(21)18(15)17-7-9-5-13-14(25-8-24-13)6-12(9)19(22)23/h1-7H,8H2 |
| InChIKey | AUMASBXFADFACX-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 111.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.26 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|