C14H9NO5 — CID 86153224
6-(2-nitrophenyl)-1,3-benzodioxole-5-carbaldehyde (PubChem CID 86153224) has the molecular formula C14H9NO5 and a molecular weight of 271.23 g/mol. Its IUPAC name is 6-(2-nitrophenyl)-1,3-benzodioxole-5-carbaldehyde.
| Compound Name | 6-(2-nitrophenyl)-1,3-benzodioxole-5-carbaldehyde |
|---|---|
| PubChem CID | 86153224 |
| Molecular Formula | C14H9NO5 |
| Molecular Weight | 271.23 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 6-(2-nitrophenyl)-1,3-benzodioxole-5-carbaldehyde |
| SMILES | O=Cc1cc2c(cc1-c1ccccc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C14H9NO5/c16-7-9-5-13-14(20-8-19-13)6-11(9)10-3-1-2-4-12(10)15(17)18/h1-7H,8H2 |
| InChIKey | BJWAFJVRXLZOCR-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.23 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|