About 6-(2-oxochromen-4-yl)-1,3-benzodioxole-5-carbaldehyde
6-(2-oxochromen-4-yl)-1,3-benzodioxole-5-carbaldehyde (PubChem CID 142966260) has the molecular formula C17H10O5
and a molecular weight of 294.26 g/mol. Its IUPAC name is 6-(2-oxochromen-4-yl)-1,3-benzodioxole-5-carbaldehyde.
Molecular Properties
| Compound Name | 6-(2-oxochromen-4-yl)-1,3-benzodioxole-5-carbaldehyde |
| PubChem CID | 142966260 |
| Molecular Formula | C17H10O5 |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 6-(2-oxochromen-4-yl)-1,3-benzodioxole-5-carbaldehyde |
| SMILES | O=Cc1cc2c(cc1-c1cc(=O)oc3ccccc13)OCO2 |
| InChI | InChI=1S/C17H10O5/c18-8-10-5-15-16(21-9-20-15)6-12(10)13-7-17(19)22-14-4-2-1-3-11(13)14/h1-8H,9H2 |
| InChIKey | PMHCHKAOFLBNKJ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 6-(2-oxochromen-4-yl)-1,3-benzodioxole-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-oxochromen-4-yl)-1,3-benzodioxole-5-carbaldehyde?
The IUPAC name of 6-(2-oxochromen-4-yl)-1,3-benzodioxole-5-carbaldehyde (CID 142966260) is 6-(2-oxochromen-4-yl)-1,3-benzodioxole-5-carbaldehyde.
What is the SMILES notation for 6-(2-oxochromen-4-yl)-1,3-benzodioxole-5-carbaldehyde?
The canonical SMILES for 6-(2-oxochromen-4-yl)-1,3-benzodioxole-5-carbaldehyde is O=Cc1cc2c(cc1-c1cc(=O)oc3ccccc13)OCO2.
What is the InChIKey of 6-(2-oxochromen-4-yl)-1,3-benzodioxole-5-carbaldehyde?
The InChIKey is PMHCHKAOFLBNKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10O5/c18-8-10-5-15-16(21-9-20-15)6-12(10)13-7-17(19)22-14-4-2-1-3-11(13)14/h1-8H,9H2.
What are the key properties of 6-(2-oxochromen-4-yl)-1,3-benzodioxole-5-carbaldehyde?
6-(2-oxochromen-4-yl)-1,3-benzodioxole-5-carbaldehyde has a molecular weight of 294.26 g/mol, XLogP of 3.00, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-oxochromen-4-yl)-1,3-benzodioxole-5-carbaldehyde is sourced from PubChem (CID 142966260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).