C18H12O4 — CID 77393328
2-[2-(1,3-benzodioxol-5-yl)ethenyl]chromen-4-one (PubChem CID 77393328) has the molecular formula C18H12O4 and a molecular weight of 292.29 g/mol. Its IUPAC name is 2-[2-(1,3-benzodioxol-5-yl)ethenyl]chromen-4-one.
| Compound Name | 2-[2-(1,3-benzodioxol-5-yl)ethenyl]chromen-4-one |
|---|---|
| PubChem CID | 77393328 |
| Molecular Formula | C18H12O4 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 2-[2-(1,3-benzodioxol-5-yl)ethenyl]chromen-4-one |
| SMILES | O=c1cc(C=Cc2ccc3c(c2)OCO3)oc2ccccc12 |
| InChI | InChI=1S/C18H12O4/c19-15-10-13(22-16-4-2-1-3-14(15)16)7-5-12-6-8-17-18(9-12)21-11-20-17/h1-10H,11H2 |
| InChIKey | APULSJXQJKBMJC-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |