C18H14ClNO2 — CID 163332896
4-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]quinoline;hydrochloride (PubChem CID 163332896) has the molecular formula C18H14ClNO2 and a molecular weight of 311.77 g/mol. Its IUPAC name is 4-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]quinoline;hydrochloride.
| Compound Name | 4-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]quinoline;hydrochloride |
|---|---|
| PubChem CID | 163332896 |
| Molecular Formula | C18H14ClNO2 |
| Molecular Weight | 311.77 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 4-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]quinoline;hydrochloride |
| SMILES | C(=C/c1ccnc2ccccc12)\c1ccc2c(c1)OCO2.Cl |
| InChI | InChI=1S/C18H13NO2.ClH/c1-2-4-16-15(3-1)14(9-10-19-16)7-5-13-6-8-17-18(11-13)21-12-20-17;/h1-11H,12H2;1H/b7-5+; |
| InChIKey | LIZMUEWBPAXXLE-GZOLSCHFSA-N |
| XLogP | 4.56 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.77 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |