C21H20N2 — CID 53315181
N,N-dimethyl-4-[(1Z,3Z)-4-quinolin-4-ylbuta-1,3-dienyl]aniline (PubChem CID 53315181) has the molecular formula C21H20N2 and a molecular weight of 300.41 g/mol. Its IUPAC name is N,N-dimethyl-4-[(1Z,3Z)-4-quinolin-4-ylbuta-1,3-dienyl]aniline.
| Compound Name | N,N-dimethyl-4-[(1Z,3Z)-4-quinolin-4-ylbuta-1,3-dienyl]aniline |
|---|---|
| PubChem CID | 53315181 |
| Molecular Formula | C21H20N2 |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | N,N-dimethyl-4-[(1Z,3Z)-4-quinolin-4-ylbuta-1,3-dienyl]aniline |
| SMILES | CN(C)c1ccc(/C=C\C=C/c2ccnc3ccccc23)cc1 |
| InChI | InChI=1S/C21H20N2/c1-23(2)19-13-11-17(12-14-19)7-3-4-8-18-15-16-22-21-10-6-5-9-20(18)21/h3-16H,1-2H3/b7-3-,8-4- |
| InChIKey | KSEFXZWTAXCYMY-VHOZIDCHSA-N |
| XLogP | 5.03 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|