C33H33N3 — CID 20724554
4-[(1E,3E)-4-[2-[(1E,3E)-4-[4-(dimethylamino)phenyl]buta-1,3-dienyl]quinolin-4-yl]buta-1,3-dienyl]-N,N-dimethylaniline (PubChem CID 20724554) has the molecular formula C33H33N3 and a molecular weight of 471.65 g/mol. Its IUPAC name is 4-[(1E,3E)-4-[2-[(1E,3E)-4-[4-(dimethylamino)phenyl]buta-1,3-dienyl]quinolin-4-yl]buta-1,3-dienyl]-N,N-dimethylaniline.
| Compound Name | 4-[(1E,3E)-4-[2-[(1E,3E)-4-[4-(dimethylamino)phenyl]buta-1,3-dienyl]quinolin-4-yl]buta-1,3-dienyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 20724554 |
| Molecular Formula | C33H33N3 |
| Molecular Weight | 471.65 g/mol |
| Exact Mass | 471.27 |
| IUPAC Name | 4-[(1E,3E)-4-[2-[(1E,3E)-4-[4-(dimethylamino)phenyl]buta-1,3-dienyl]quinolin-4-yl]buta-1,3-dienyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/C=C/C=C/c2cc(/C=C/C=C/c3ccc(N(C)C)cc3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C33H33N3/c1-35(2)30-21-17-26(18-22-30)11-5-7-13-28-25-29(34-33-16-10-9-15-32(28)33)14-8-6-12-27-19-23-31(24-20-27)36(3)4/h5-25H,1-4H3/b11-5+,12-6+,13-7+,14-8+ |
| InChIKey | SNGYMIFLJAIAFN-JRXATRHQSA-N |
| XLogP | 7.82 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.65 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|