C30H22N2O2 — CID 3875764
2-[2-[4-(N-phenylanilino)phenyl]ethenyl]quinoline-4-carboxylic acid (PubChem CID 3875764) has the molecular formula C30H22N2O2 and a molecular weight of 442.52 g/mol. Its IUPAC name is 2-[2-[4-(N-phenylanilino)phenyl]ethenyl]quinoline-4-carboxylic acid.
| Compound Name | 2-[2-[4-(N-phenylanilino)phenyl]ethenyl]quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 3875764 |
| Molecular Formula | C30H22N2O2 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 2-[2-[4-(N-phenylanilino)phenyl]ethenyl]quinoline-4-carboxylic acid |
| SMILES | O=C(O)c1cc(C=Cc2ccc(N(c3ccccc3)c3ccccc3)cc2)nc2ccccc12 |
| InChI | InChI=1S/C30H22N2O2/c33-30(34)28-21-23(31-29-14-8-7-13-27(28)29)18-15-22-16-19-26(20-17-22)32(24-9-3-1-4-10-24)25-11-5-2-6-12-25/h1-21H,(H,33,34) |
| InChIKey | KNGHFHJFGYFOKL-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |