C21H18NO3- — CID 7895126
2-[(E)-2-(4-propoxyphenyl)ethenyl]quinoline-4-carboxylate (PubChem CID 7895126) has the molecular formula C21H18NO3- and a molecular weight of 332.38 g/mol. Its IUPAC name is 2-[(E)-2-(4-propoxyphenyl)ethenyl]quinoline-4-carboxylate.
| Compound Name | 2-[(E)-2-(4-propoxyphenyl)ethenyl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 7895126 |
| Molecular Formula | C21H18NO3- |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 2-[(E)-2-(4-propoxyphenyl)ethenyl]quinoline-4-carboxylate |
| SMILES | CCCOc1ccc(/C=C/c2cc(C(=O)[O-])c3ccccc3n2)cc1 |
| InChI | InChI=1S/C21H19NO3/c1-2-13-25-17-11-8-15(9-12-17)7-10-16-14-19(21(23)24)18-5-3-4-6-20(18)22-16/h3-12,14H,2,13H2,1H3,(H,23,24)/p-1/b10-7+ |
| InChIKey | SMTLQXNYQHAIRQ-JXMROGBWSA-M |
| XLogP | 3.56 |
| TPSA | 62.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |