C23H22NO4- — CID 7971613
2-[(E)-2-(3-butoxy-4-methoxyphenyl)ethenyl]quinoline-4-carboxylate (PubChem CID 7971613) has the molecular formula C23H22NO4- and a molecular weight of 376.43 g/mol. Its IUPAC name is 2-[(E)-2-(3-butoxy-4-methoxyphenyl)ethenyl]quinoline-4-carboxylate.
| Compound Name | 2-[(E)-2-(3-butoxy-4-methoxyphenyl)ethenyl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 7971613 |
| Molecular Formula | C23H22NO4- |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 2-[(E)-2-(3-butoxy-4-methoxyphenyl)ethenyl]quinoline-4-carboxylate |
| SMILES | CCCCOc1cc(/C=C/c2cc(C(=O)[O-])c3ccccc3n2)ccc1OC |
| InChI | InChI=1S/C23H23NO4/c1-3-4-13-28-22-14-16(10-12-21(22)27-2)9-11-17-15-19(23(25)26)18-7-5-6-8-20(18)24-17/h5-12,14-15H,3-4,13H2,1-2H3,(H,25,26)/p-1/b11-9+ |
| InChIKey | JJHJFNHXPVAGLI-PKNBQFBNSA-M |
| XLogP | 3.96 |
| TPSA | 71.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|