C22H18NO4- — CID 8020196
2-[(E)-2-(3-methoxy-4-prop-2-enoxyphenyl)ethenyl]quinoline-4-carboxylate (PubChem CID 8020196) has the molecular formula C22H18NO4- and a molecular weight of 360.39 g/mol. Its IUPAC name is 2-[(E)-2-(3-methoxy-4-prop-2-enoxyphenyl)ethenyl]quinoline-4-carboxylate.
| Compound Name | 2-[(E)-2-(3-methoxy-4-prop-2-enoxyphenyl)ethenyl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 8020196 |
| Molecular Formula | C22H18NO4- |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 2-[(E)-2-(3-methoxy-4-prop-2-enoxyphenyl)ethenyl]quinoline-4-carboxylate |
| SMILES | C=CCOc1ccc(/C=C/c2cc(C(=O)[O-])c3ccccc3n2)cc1OC |
| InChI | InChI=1S/C22H19NO4/c1-3-12-27-20-11-9-15(13-21(20)26-2)8-10-16-14-18(22(24)25)17-6-4-5-7-19(17)23-16/h3-11,13-14H,1,12H2,2H3,(H,24,25)/p-1/b10-8+ |
| InChIKey | FYNQHNNYJFMOKG-CSKARUKUSA-M |
| XLogP | 3.34 |
| TPSA | 71.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|