C36H34O4 — CID 54438729
2-methoxy-4-[2-[4-[4-[2-(3-methoxy-4-prop-2-enoxyphenyl)ethenyl]phenyl]phenyl]ethenyl]-1-prop-2-enoxybenzene (PubChem CID 54438729) has the molecular formula C36H34O4 and a molecular weight of 530.66 g/mol. Its IUPAC name is 2-methoxy-4-[2-[4-[4-[2-(3-methoxy-4-prop-2-enoxyphenyl)ethenyl]phenyl]phenyl]ethenyl]-1-prop-2-enoxybenzene.
| Compound Name | 2-methoxy-4-[2-[4-[4-[2-(3-methoxy-4-prop-2-enoxyphenyl)ethenyl]phenyl]phenyl]ethenyl]-1-prop-2-enoxybenzene |
|---|---|
| PubChem CID | 54438729 |
| Molecular Formula | C36H34O4 |
| Molecular Weight | 530.66 g/mol |
| Exact Mass | 530.25 |
| IUPAC Name | 2-methoxy-4-[2-[4-[4-[2-(3-methoxy-4-prop-2-enoxyphenyl)ethenyl]phenyl]phenyl]ethenyl]-1-prop-2-enoxybenzene |
| SMILES | C=CCOc1ccc(C=Cc2ccc(-c3ccc(C=Cc4ccc(OCC=C)c(OC)c4)cc3)cc2)cc1OC |
| InChI | InChI=1S/C36H34O4/c1-5-23-39-33-21-15-29(25-35(33)37-3)9-7-27-11-17-31(18-12-27)32-19-13-28(14-20-32)8-10-30-16-22-34(40-24-6-2)36(26-30)38-4/h5-22,25-26H,1-2,23-24H2,3-4H3 |
| InChIKey | WMOPNPBHVJFDPJ-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.66 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|