C16H19NO5 — CID 175481033
(2S)-2-amino-6-(3-methoxy-4-prop-2-enoxyphenyl)-4-oxohex-5-enoic acid (PubChem CID 175481033) has the molecular formula C16H19NO5 and a molecular weight of 305.33 g/mol. Its IUPAC name is (2S)-2-amino-6-(3-methoxy-4-prop-2-enoxyphenyl)-4-oxohex-5-enoic acid.
| Compound Name | (2S)-2-amino-6-(3-methoxy-4-prop-2-enoxyphenyl)-4-oxohex-5-enoic acid |
|---|---|
| PubChem CID | 175481033 |
| Molecular Formula | C16H19NO5 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | (2S)-2-amino-6-(3-methoxy-4-prop-2-enoxyphenyl)-4-oxohex-5-enoic acid |
| SMILES | C=CCOc1ccc(C=CC(=O)C[C@H](N)C(=O)O)cc1OC |
| InChI | InChI=1S/C16H19NO5/c1-3-8-22-14-7-5-11(9-15(14)21-2)4-6-12(18)10-13(17)16(19)20/h3-7,9,13H,1,8,10,17H2,2H3,(H,19,20)/t13-/m0/s1 |
| InChIKey | JYRYMDVGIZSLQL-ZDUSSCGKSA-N |
| XLogP | 1.64 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|