C27H30O8 — CID 177249950
methyl 3-[(E)-3-[3,4-bis(prop-2-enoxy)phenyl]prop-2-enoyl]oxy-3-(3,4-dimethoxyphenyl)propanoate (PubChem CID 177249950) has the molecular formula C27H30O8 and a molecular weight of 482.53 g/mol. Its IUPAC name is methyl 3-[(E)-3-[3,4-bis(prop-2-enoxy)phenyl]prop-2-enoyl]oxy-3-(3,4-dimethoxyphenyl)propanoate.
| Compound Name | methyl 3-[(E)-3-[3,4-bis(prop-2-enoxy)phenyl]prop-2-enoyl]oxy-3-(3,4-dimethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 177249950 |
| Molecular Formula | C27H30O8 |
| Molecular Weight | 482.53 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | methyl 3-[(E)-3-[3,4-bis(prop-2-enoxy)phenyl]prop-2-enoyl]oxy-3-(3,4-dimethoxyphenyl)propanoate |
| SMILES | C=CCOc1ccc(/C=C/C(=O)OC(CC(=O)OC)c2ccc(OC)c(OC)c2)cc1OCC=C |
| InChI | InChI=1S/C27H30O8/c1-6-14-33-22-11-8-19(16-25(22)34-15-7-2)9-13-26(28)35-23(18-27(29)32-5)20-10-12-21(30-3)24(17-20)31-4/h6-13,16-17,23H,1-2,14-15,18H2,3-5H3/b13-9+ |
| InChIKey | LDGMQVXHWHDVEV-UKTHLTGXSA-N |
| XLogP | 4.69 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.53 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|