C32H38O9 — CID 177249040
methyl 3-[(E)-3-[3,4-bis(prop-2-enoxy)phenyl]prop-2-enoyl]oxy-3-(2,6-dimethoxy-4-prop-2-enoxyphenyl)-2,2-dimethylpropanoate (PubChem CID 177249040) has the molecular formula C32H38O9 and a molecular weight of 566.65 g/mol. Its IUPAC name is methyl 3-[(E)-3-[3,4-bis(prop-2-enoxy)phenyl]prop-2-enoyl]oxy-3-(2,6-dimethoxy-4-prop-2-enoxyphenyl)-2,2-dimethylpropanoate.
| Compound Name | methyl 3-[(E)-3-[3,4-bis(prop-2-enoxy)phenyl]prop-2-enoyl]oxy-3-(2,6-dimethoxy-4-prop-2-enoxyphenyl)-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 177249040 |
| Molecular Formula | C32H38O9 |
| Molecular Weight | 566.65 g/mol |
| Exact Mass | 566.25 |
| IUPAC Name | methyl 3-[(E)-3-[3,4-bis(prop-2-enoxy)phenyl]prop-2-enoyl]oxy-3-(2,6-dimethoxy-4-prop-2-enoxyphenyl)-2,2-dimethylpropanoate |
| SMILES | C=CCOc1cc(OC)c(C(OC(=O)/C=C/c2ccc(OCC=C)c(OCC=C)c2)C(C)(C)C(=O)OC)c(OC)c1 |
| InChI | InChI=1S/C32H38O9/c1-9-16-38-23-20-26(35-6)29(27(21-23)36-7)30(32(4,5)31(34)37-8)41-28(33)15-13-22-12-14-24(39-17-10-2)25(19-22)40-18-11-3/h9-15,19-21,30H,1-3,16-18H2,4-8H3/b15-13+ |
| InChIKey | VLLRAFAQZHVPQZ-FYWRMAATSA-N |
| XLogP | 5.90 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.65 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|