C18H19F3N2O6 — CID 8952331
[2-oxo-2-(2,2,2-trifluoroethylcarbamoylamino)ethyl] (E)-3-(3-methoxy-4-prop-2-enoxyphenyl)prop-2-enoate (PubChem CID 8952331) has the molecular formula C18H19F3N2O6 and a molecular weight of 416.35 g/mol. Its IUPAC name is [2-oxo-2-(2,2,2-trifluoroethylcarbamoylamino)ethyl] (E)-3-(3-methoxy-4-prop-2-enoxyphenyl)prop-2-enoate.
| Compound Name | [2-oxo-2-(2,2,2-trifluoroethylcarbamoylamino)ethyl] (E)-3-(3-methoxy-4-prop-2-enoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8952331 |
| Molecular Formula | C18H19F3N2O6 |
| Molecular Weight | 416.35 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | [2-oxo-2-(2,2,2-trifluoroethylcarbamoylamino)ethyl] (E)-3-(3-methoxy-4-prop-2-enoxyphenyl)prop-2-enoate |
| SMILES | C=CCOc1ccc(/C=C/C(=O)OCC(=O)NC(=O)NCC(F)(F)F)cc1OC |
| InChI | InChI=1S/C18H19F3N2O6/c1-3-8-28-13-6-4-12(9-14(13)27-2)5-7-16(25)29-10-15(24)23-17(26)22-11-18(19,20)21/h3-7,9H,1,8,10-11H2,2H3,(H2,22,23,24,26)/b7-5+ |
| InChIKey | CWKXJUUIUWKGJL-FNORWQNLSA-N |
| XLogP | 2.20 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.35 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|