C21H21N3O7 — CID 18289706
[2-oxo-2-(phenylcarbamoylamino)ethyl] (E)-3-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]prop-2-enoate (PubChem CID 18289706) has the molecular formula C21H21N3O7 and a molecular weight of 427.41 g/mol. Its IUPAC name is [2-oxo-2-(phenylcarbamoylamino)ethyl] (E)-3-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]prop-2-enoate.
| Compound Name | [2-oxo-2-(phenylcarbamoylamino)ethyl] (E)-3-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 18289706 |
| Molecular Formula | C21H21N3O7 |
| Molecular Weight | 427.41 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | [2-oxo-2-(phenylcarbamoylamino)ethyl] (E)-3-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCC(=O)NC(=O)Nc2ccccc2)ccc1OCC(N)=O |
| InChI | InChI=1S/C21H21N3O7/c1-29-17-11-14(7-9-16(17)30-12-18(22)25)8-10-20(27)31-13-19(26)24-21(28)23-15-5-3-2-4-6-15/h2-11H,12-13H2,1H3,(H2,22,25)(H2,23,24,26,28)/b10-8+ |
| InChIKey | DVKRZQQGMWWHHE-CSKARUKUSA-N |
| XLogP | 1.46 |
| TPSA | 146.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.41 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|