C20H22N2O6S — CID 27043966
[2-oxo-2-(2-thiophen-2-ylethylamino)ethyl] (E)-3-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]prop-2-enoate (PubChem CID 27043966) has the molecular formula C20H22N2O6S and a molecular weight of 418.47 g/mol. Its IUPAC name is [2-oxo-2-(2-thiophen-2-ylethylamino)ethyl] (E)-3-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]prop-2-enoate.
| Compound Name | [2-oxo-2-(2-thiophen-2-ylethylamino)ethyl] (E)-3-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 27043966 |
| Molecular Formula | C20H22N2O6S |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | [2-oxo-2-(2-thiophen-2-ylethylamino)ethyl] (E)-3-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCC(=O)NCCc2cccs2)ccc1OCC(N)=O |
| InChI | InChI=1S/C20H22N2O6S/c1-26-17-11-14(4-6-16(17)27-12-18(21)23)5-7-20(25)28-13-19(24)22-9-8-15-3-2-10-29-15/h2-7,10-11H,8-9,12-13H2,1H3,(H2,21,23)(H,22,24)/b7-5+ |
| InChIKey | BGVSMWBXZAAKAO-FNORWQNLSA-N |
| XLogP | 1.54 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|