C18H19NO3S — CID 9061008
[2-oxo-2-(2-thiophen-2-ylethylamino)ethyl] (E)-3-(3-methylphenyl)prop-2-enoate (PubChem CID 9061008) has the molecular formula C18H19NO3S and a molecular weight of 329.42 g/mol. Its IUPAC name is [2-oxo-2-(2-thiophen-2-ylethylamino)ethyl] (E)-3-(3-methylphenyl)prop-2-enoate.
| Compound Name | [2-oxo-2-(2-thiophen-2-ylethylamino)ethyl] (E)-3-(3-methylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 9061008 |
| Molecular Formula | C18H19NO3S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | [2-oxo-2-(2-thiophen-2-ylethylamino)ethyl] (E)-3-(3-methylphenyl)prop-2-enoate |
| SMILES | Cc1cccc(/C=C/C(=O)OCC(=O)NCCc2cccs2)c1 |
| InChI | InChI=1S/C18H19NO3S/c1-14-4-2-5-15(12-14)7-8-18(21)22-13-17(20)19-10-9-16-6-3-11-23-16/h2-8,11-12H,9-10,13H2,1H3,(H,19,20)/b8-7+ |
| InChIKey | URRYASYJVXTPIJ-BQYQJAHWSA-N |
| XLogP | 2.97 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|