C33H36O8 — CID 10973744
prop-2-enyl (2S)-3-[3,4-bis(prop-2-enoxy)phenyl]-2-[(E)-3-[3,4-bis(prop-2-enoxy)phenyl]prop-2-enoyl]oxypropanoate (PubChem CID 10973744) has the molecular formula C33H36O8 and a molecular weight of 560.64 g/mol. Its IUPAC name is prop-2-enyl (2S)-3-[3,4-bis(prop-2-enoxy)phenyl]-2-[(E)-3-[3,4-bis(prop-2-enoxy)phenyl]prop-2-enoyl]oxypropanoate.
| Compound Name | prop-2-enyl (2S)-3-[3,4-bis(prop-2-enoxy)phenyl]-2-[(E)-3-[3,4-bis(prop-2-enoxy)phenyl]prop-2-enoyl]oxypropanoate |
|---|---|
| PubChem CID | 10973744 |
| Molecular Formula | C33H36O8 |
| Molecular Weight | 560.64 g/mol |
| Exact Mass | 560.24 |
| IUPAC Name | prop-2-enyl (2S)-3-[3,4-bis(prop-2-enoxy)phenyl]-2-[(E)-3-[3,4-bis(prop-2-enoxy)phenyl]prop-2-enoyl]oxypropanoate |
| SMILES | C=CCOC(=O)[C@H](Cc1ccc(OCC=C)c(OCC=C)c1)OC(=O)/C=C/c1ccc(OCC=C)c(OCC=C)c1 |
| InChI | InChI=1S/C33H36O8/c1-6-17-36-27-14-11-25(22-29(27)38-19-8-3)13-16-32(34)41-31(33(35)40-21-10-5)24-26-12-15-28(37-18-7-2)30(23-26)39-20-9-4/h6-16,22-23,31H,1-5,17-21,24H2/b16-13+/t31-/m0/s1 |
| InChIKey | YAIGIGFVTAEUSC-GSDIUPAVSA-N |
| XLogP | 5.84 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.64 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|