C24H25BrO6 — CID 71698903
[3-(3,4-dimethoxyphenyl)-1-oxo-1-prop-2-enoxypropan-2-yl] (E)-4-(4-bromophenyl)but-2-enoate (PubChem CID 71698903) has the molecular formula C24H25BrO6 and a molecular weight of 489.36 g/mol. Its IUPAC name is [3-(3,4-dimethoxyphenyl)-1-oxo-1-prop-2-enoxypropan-2-yl] (E)-4-(4-bromophenyl)but-2-enoate.
| Compound Name | [3-(3,4-dimethoxyphenyl)-1-oxo-1-prop-2-enoxypropan-2-yl] (E)-4-(4-bromophenyl)but-2-enoate |
|---|---|
| PubChem CID | 71698903 |
| Molecular Formula | C24H25BrO6 |
| Molecular Weight | 489.36 g/mol |
| Exact Mass | 488.08 |
| IUPAC Name | [3-(3,4-dimethoxyphenyl)-1-oxo-1-prop-2-enoxypropan-2-yl] (E)-4-(4-bromophenyl)but-2-enoate |
| SMILES | C=CCOC(=O)C(Cc1ccc(OC)c(OC)c1)OC(=O)/C=C/Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C24H25BrO6/c1-4-14-30-24(27)22(16-18-10-13-20(28-2)21(15-18)29-3)31-23(26)7-5-6-17-8-11-19(25)12-9-17/h4-5,7-13,15,22H,1,6,14,16H2,2-3H3/b7-5+ |
| InChIKey | OLQZSJAQRDSLKX-FNORWQNLSA-N |
| XLogP | 4.45 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.36 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|