C20H19FO6 — CID 71652193
3-(3,4-dimethoxyphenyl)-2-[(E)-3-(2-fluorophenyl)prop-2-enoyl]oxypropanoic acid (PubChem CID 71652193) has the molecular formula C20H19FO6 and a molecular weight of 374.36 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-2-[(E)-3-(2-fluorophenyl)prop-2-enoyl]oxypropanoic acid.
| Compound Name | 3-(3,4-dimethoxyphenyl)-2-[(E)-3-(2-fluorophenyl)prop-2-enoyl]oxypropanoic acid |
|---|---|
| PubChem CID | 71652193 |
| Molecular Formula | C20H19FO6 |
| Molecular Weight | 374.36 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-2-[(E)-3-(2-fluorophenyl)prop-2-enoyl]oxypropanoic acid |
| SMILES | COc1ccc(CC(OC(=O)/C=C/c2ccccc2F)C(=O)O)cc1OC |
| InChI | InChI=1S/C20H19FO6/c1-25-16-9-7-13(11-17(16)26-2)12-18(20(23)24)27-19(22)10-8-14-5-3-4-6-15(14)21/h3-11,18H,12H2,1-2H3,(H,23,24)/b10-8+ |
| InChIKey | FEZMNPXILMKQSD-CSKARUKUSA-N |
| XLogP | 3.10 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|