C28H24O10 — CID 137477237
2-[(E)-3-[2-(3,4-dihydroxyphenyl)-7-methoxy-1-benzofuran-4-yl]prop-2-enoyl]oxy-3-(4-hydroxy-3-methoxyphenyl)propanoic acid (PubChem CID 137477237) has the molecular formula C28H24O10 and a molecular weight of 520.49 g/mol. Its IUPAC name is 2-[(E)-3-[2-(3,4-dihydroxyphenyl)-7-methoxy-1-benzofuran-4-yl]prop-2-enoyl]oxy-3-(4-hydroxy-3-methoxyphenyl)propanoic acid.
| Compound Name | 2-[(E)-3-[2-(3,4-dihydroxyphenyl)-7-methoxy-1-benzofuran-4-yl]prop-2-enoyl]oxy-3-(4-hydroxy-3-methoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 137477237 |
| Molecular Formula | C28H24O10 |
| Molecular Weight | 520.49 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | 2-[(E)-3-[2-(3,4-dihydroxyphenyl)-7-methoxy-1-benzofuran-4-yl]prop-2-enoyl]oxy-3-(4-hydroxy-3-methoxyphenyl)propanoic acid |
| SMILES | COc1cc(CC(OC(=O)/C=C/c2ccc(OC)c3oc(-c4ccc(O)c(O)c4)cc23)C(=O)O)ccc1O |
| InChI | InChI=1S/C28H24O10/c1-35-22-9-5-16(18-14-23(38-27(18)22)17-4-8-19(29)21(31)13-17)6-10-26(32)37-25(28(33)34)12-15-3-7-20(30)24(11-15)36-2/h3-11,13-14,25,29-31H,12H2,1-2H3,(H,33,34)/b10-6+ |
| InChIKey | LDQLWSGVTCMKQL-UXBLZVDNSA-N |
| XLogP | 4.49 |
| TPSA | 155.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.49 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|