C30H29NO9 — CID 130301154
methyl (2S)-3-(3,4-dihydroxyphenyl)-2-[[(E)-3-[2-(3,4-dimethoxyphenyl)-7-methoxy-1-benzofuran-4-yl]prop-2-enoyl]amino]propanoate (PubChem CID 130301154) has the molecular formula C30H29NO9 and a molecular weight of 547.56 g/mol. Its IUPAC name is methyl (2S)-3-(3,4-dihydroxyphenyl)-2-[[(E)-3-[2-(3,4-dimethoxyphenyl)-7-methoxy-1-benzofuran-4-yl]prop-2-enoyl]amino]propanoate.
| Compound Name | methyl (2S)-3-(3,4-dihydroxyphenyl)-2-[[(E)-3-[2-(3,4-dimethoxyphenyl)-7-methoxy-1-benzofuran-4-yl]prop-2-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 130301154 |
| Molecular Formula | C30H29NO9 |
| Molecular Weight | 547.56 g/mol |
| Exact Mass | 547.18 |
| IUPAC Name | methyl (2S)-3-(3,4-dihydroxyphenyl)-2-[[(E)-3-[2-(3,4-dimethoxyphenyl)-7-methoxy-1-benzofuran-4-yl]prop-2-enoyl]amino]propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(O)c(O)c1)NC(=O)/C=C/c1ccc(OC)c2oc(-c3ccc(OC)c(OC)c3)cc12 |
| InChI | InChI=1S/C30H29NO9/c1-36-24-10-7-19(15-27(24)38-3)26-16-20-18(6-11-25(37-2)29(20)40-26)8-12-28(34)31-21(30(35)39-4)13-17-5-9-22(32)23(33)14-17/h5-12,14-16,21,32-33H,13H2,1-4H3,(H,31,34)/b12-8+/t21-/m0/s1 |
| InChIKey | HRNBIHVCAQTNEY-HSRJRILOSA-N |
| XLogP | 4.45 |
| TPSA | 136.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.56 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|